C11H23F4NO2 — CID 155706892
ethane;1,2,2,2-tetrafluoro-N-[2-(2-propoxyethoxy)ethyl]ethanamine (PubChem CID 155706892) has the molecular formula C11H23F4NO2 and a molecular weight of 277.30 g/mol. Its IUPAC name is ethane;1,2,2,2-tetrafluoro-N-[2-(2-propoxyethoxy)ethyl]ethanamine.
| Compound Name | ethane;1,2,2,2-tetrafluoro-N-[2-(2-propoxyethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 155706892 |
| Molecular Formula | C11H23F4NO2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethane;1,2,2,2-tetrafluoro-N-[2-(2-propoxyethoxy)ethyl]ethanamine |
| SMILES | CC.CCCOCCOCCNC(F)C(F)(F)F |
| InChI | InChI=1S/C9H17F4NO2.C2H6/c1-2-4-15-6-7-16-5-3-14-8(10)9(11,12)13;1-2/h8,14H,2-7H2,1H3;1-2H3 |
| InChIKey | LFPCHGICNLRHAB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|