C5H4F8O — CID 15570695
1,1,1,2,3,4,4,4-octafluoro-2-methoxybutane (PubChem CID 15570695) has the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. Its IUPAC name is 1,1,1,2,3,4,4,4-octafluoro-2-methoxybutane.
| Compound Name | 1,1,1,2,3,4,4,4-octafluoro-2-methoxybutane |
|---|---|
| PubChem CID | 15570695 |
| Molecular Formula | C5H4F8O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1,1,1,2,3,4,4,4-octafluoro-2-methoxybutane |
| SMILES | COC(F)(C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F8O/c1-14-3(7,5(11,12)13)2(6)4(8,9)10/h2H,1H3 |
| InChIKey | VCXVWLMCQVUVCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |