About CID 155707132
CID 155707132 (PubChem CID 155707132) has the molecular formula C13H23BN2
and a molecular weight of 218.15 g/mol.
Molecular Properties
| Compound Name | CID 155707132 |
| PubChem CID | 155707132 |
| Molecular Formula | C13H23BN2 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)CC1=C(CCC)N(C)/C(=N/C)C1 |
| InChI | InChI=1S/C13H23BN2/c1-6-7-11-10(9-13(2,3)14)8-12(15-4)16(11)5/h6-9H2,1-5H3/b15-12+ |
| InChIKey | BTKDMEBDMAVBJW-NTCAYCPXSA-N |
| XLogP | 3.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 155707132 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155707132?
The IUPAC name of CID 155707132 (CID 155707132) is not available.
What is the SMILES notation for CID 155707132?
The canonical SMILES for CID 155707132 is [B]C(C)(C)CC1=C(CCC)N(C)/C(=N/C)C1.
What is the InChIKey of CID 155707132?
The InChIKey is BTKDMEBDMAVBJW-NTCAYCPXSA-N. The full InChI is InChI=1S/C13H23BN2/c1-6-7-11-10(9-13(2,3)14)8-12(15-4)16(11)5/h6-9H2,1-5H3/b15-12+.
What are the key properties of CID 155707132?
CID 155707132 has a molecular weight of 218.15 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155707132 is sourced from PubChem (CID 155707132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).