C25H32 — CID 155708904
1-(3-cyclobutylprop-1-en-2-yl)-4-[(3E,6Z,8Z)-6-methylundeca-3,6,8,10-tetraen-3-yl]benzene (PubChem CID 155708904) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-(3-cyclobutylprop-1-en-2-yl)-4-[(3E,6Z,8Z)-6-methylundeca-3,6,8,10-tetraen-3-yl]benzene.
| Compound Name | 1-(3-cyclobutylprop-1-en-2-yl)-4-[(3E,6Z,8Z)-6-methylundeca-3,6,8,10-tetraen-3-yl]benzene |
|---|---|
| PubChem CID | 155708904 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-(3-cyclobutylprop-1-en-2-yl)-4-[(3E,6Z,8Z)-6-methylundeca-3,6,8,10-tetraen-3-yl]benzene |
| SMILES | C=C/C=C\C=C(\C)C/C=C(\CC)c1ccc(C(=C)CC2CCC2)cc1 |
| InChI | InChI=1S/C25H32/c1-5-7-8-10-20(3)13-14-23(6-2)25-17-15-24(16-18-25)21(4)19-22-11-9-12-22/h5,7-8,10,14-18,22H,1,4,6,9,11-13,19H2,2-3H3/b8-7-,20-10-,23-14+ |
| InChIKey | IQKQVUXPUNNRNT-ULTWOICASA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|