C13H18FN3 — CID 155708968
ethane;4-(3-fluorophenyl)-1-propyltriazole (PubChem CID 155708968) has the molecular formula C13H18FN3 and a molecular weight of 235.31 g/mol. Its IUPAC name is ethane;4-(3-fluorophenyl)-1-propyltriazole.
| Compound Name | ethane;4-(3-fluorophenyl)-1-propyltriazole |
|---|---|
| PubChem CID | 155708968 |
| Molecular Formula | C13H18FN3 |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | ethane;4-(3-fluorophenyl)-1-propyltriazole |
| SMILES | CC.CCCn1cc(-c2cccc(F)c2)nn1 |
| InChI | InChI=1S/C11H12FN3.C2H6/c1-2-6-15-8-11(13-14-15)9-4-3-5-10(12)7-9;1-2/h3-5,7-8H,2,6H2,1H3;1-2H3 |
| InChIKey | BFKHYFXVJZGULG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |