C24H26FN7O2 — CID 155709237
N-cyclopropyl-4-[[4-[1-(fluoromethyl)cyclopropyl]-1,3-oxazol-2-yl]amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide (PubChem CID 155709237) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is N-cyclopropyl-4-[[4-[1-(fluoromethyl)cyclopropyl]-1,3-oxazol-2-yl]amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide.
| Compound Name | N-cyclopropyl-4-[[4-[1-(fluoromethyl)cyclopropyl]-1,3-oxazol-2-yl]amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155709237 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-cyclopropyl-4-[[4-[1-(fluoromethyl)cyclopropyl]-1,3-oxazol-2-yl]amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CC1)c1cnc(Nc2ccc3c(c2)CCNC3)nc1Nc1nc(C2(CF)CC2)co1 |
| InChI | InChI=1S/C24H26FN7O2/c25-13-24(6-7-24)19-12-34-23(30-19)32-20-18(21(33)28-16-3-4-16)11-27-22(31-20)29-17-2-1-15-10-26-8-5-14(15)9-17/h1-2,9,11-12,16,26H,3-8,10,13H2,(H,28,33)(H2,27,29,30,31,32) |
| InChIKey | IRLUWOFYYOKRAF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |