C17H27N — CID 155709769
1,1-dimethyl-2,6-di(propan-2-yl)-3,4-dihydroisoquinoline (PubChem CID 155709769) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1,1-dimethyl-2,6-di(propan-2-yl)-3,4-dihydroisoquinoline.
| Compound Name | 1,1-dimethyl-2,6-di(propan-2-yl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 155709769 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1,1-dimethyl-2,6-di(propan-2-yl)-3,4-dihydroisoquinoline |
| SMILES | CC(C)c1ccc2c(c1)CCN(C(C)C)C2(C)C |
| InChI | InChI=1S/C17H27N/c1-12(2)14-7-8-16-15(11-14)9-10-18(13(3)4)17(16,5)6/h7-8,11-13H,9-10H2,1-6H3 |
| InChIKey | PCBUVVDZKRRZPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |