C13H20N2O — CID 155709873
4-ethyl-2,3,5,6,7,8-hexahydropyrido[3,2-i][1,4]oxazecine (PubChem CID 155709873) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-ethyl-2,3,5,6,7,8-hexahydropyrido[3,2-i][1,4]oxazecine.
| Compound Name | 4-ethyl-2,3,5,6,7,8-hexahydropyrido[3,2-i][1,4]oxazecine |
|---|---|
| PubChem CID | 155709873 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-ethyl-2,3,5,6,7,8-hexahydropyrido[3,2-i][1,4]oxazecine |
| SMILES | CCN1CCCCc2cccnc2OCC1 |
| InChI | InChI=1S/C13H20N2O/c1-2-15-9-4-3-6-12-7-5-8-14-13(12)16-11-10-15/h5,7-8H,2-4,6,9-11H2,1H3 |
| InChIKey | WSBVAKCJBKEPAP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |