C20H39N3O4 — CID 155711129
1-[2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethoxy]-4-methylpentan-3-one;ethane (PubChem CID 155711129) has the molecular formula C20H39N3O4 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-[2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethoxy]-4-methylpentan-3-one;ethane.
| Compound Name | 1-[2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethoxy]-4-methylpentan-3-one;ethane |
|---|---|
| PubChem CID | 155711129 |
| Molecular Formula | C20H39N3O4 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.29 |
| IUPAC Name | 1-[2-[2-[2-(4-tert-butyltriazol-1-yl)ethoxy]ethoxy]ethoxy]-4-methylpentan-3-one;ethane |
| SMILES | CC.CC(C)C(=O)CCOCCOCCOCCn1cc(C(C)(C)C)nn1 |
| InChI | InChI=1S/C18H33N3O4.C2H6/c1-15(2)16(22)6-8-23-10-12-25-13-11-24-9-7-21-14-17(19-20-21)18(3,4)5;1-2/h14-15H,6-13H2,1-5H3;1-2H3 |
| InChIKey | VNHCTNGBWXMUDI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|