C44H37BF2N2O2 — CID 155711160
[4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 3-perylen-3-ylpropanoate (PubChem CID 155711160) has the molecular formula C44H37BF2N2O2 and a molecular weight of 674.60 g/mol. Its IUPAC name is [4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 3-perylen-3-ylpropanoate.
| Compound Name | [4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 3-perylen-3-ylpropanoate |
|---|---|
| PubChem CID | 155711160 |
| Molecular Formula | C44H37BF2N2O2 |
| Molecular Weight | 674.60 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | [4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-3,5-dimethylphenyl] 3-perylen-3-ylpropanoate |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1c(C)cc(OC(=O)CCc3ccc4c5cccc6cccc(c7cccc3c74)c65)cc1C)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C44H37BF2N2O2/c1-24-22-32(23-25(2)39(24)42-43-26(3)20-28(5)48(43)45(46,47)49-29(6)21-27(4)44(42)49)51-38(50)19-17-30-16-18-37-35-14-8-11-31-10-7-13-34(40(31)35)36-15-9-12-33(30)41(36)37/h7-16,18,20-23H,17,19H2,1-6H3 |
| InChIKey | BEWYUHBPLFYKMU-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.60 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|