About CID 155711171
CID 155711171 (PubChem CID 155711171) has the molecular formula C55H50BF9N2O6+
and a molecular weight of 1016.81 g/mol.
Molecular Properties
| Compound Name | CID 155711171 |
| PubChem CID | 155711171 |
| Molecular Formula | C55H50BF9N2O6+ |
| Molecular Weight | 1016.81 g/mol |
| Exact Mass | 1016.36 |
| IUPAC Name | — |
| SMILES | CC.CCCCc1ccc2c3ccc(C(F)(F)F)c4c(C(F)(F)F)ccc(c5ccc(C(F)(F)F)c1c25)c43.CCOC(=O)C1=CC2=C(c3c(C)cc(OC=O)cc3C)c3cc(C(=O)OCC)c(C)n3[B][N+]2=C1C |
| InChI | InChI=1S/C27H17F9.C26H27BN2O6.C2H6/c1-2-3-4-13-5-6-14-16-8-11-19(26(31,32)33)24-20(27(34,35)36)12-9-17(23(16)24)15-7-10-18(25(28,29)30)21(13)22(14)15;1-7-33-25(31)19-11-21-24(23-14(3)9-18(35-13-30)10-15(23)4)22-12-20(26(32)34-8-2)17(6)29(22)27-28(21)16(19)5;1-2/h5-12H,2-4H2,1H3;9-13H,7-8H2,1-6H3;1-2H3/q;+1; |
| InChIKey | LMZWINKLVAKELY-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1016.81 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 155711171 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155711171?
The IUPAC name of CID 155711171 (CID 155711171) is not available.
What is the SMILES notation for CID 155711171?
The canonical SMILES for CID 155711171 is CC.CCCCc1ccc2c3ccc(C(F)(F)F)c4c(C(F)(F)F)ccc(c5ccc(C(F)(F)F)c1c25)c43.CCOC(=O)C1=CC2=C(c3c(C)cc(OC=O)cc3C)c3cc(C(=O)OCC)c(C)n3[B][N+]2=C1C.
What is the InChIKey of CID 155711171?
The InChIKey is LMZWINKLVAKELY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17F9.C26H27BN2O6.C2H6/c1-2-3-4-13-5-6-14-16-8-11-19(26(31,32)33)24-20(27(34,35)36)12-9-17(23(16)24)15-7-10-18(25(28,29)30)21(13)22(14)15;1-7-33-25(31)19-11-21-24(23-14(3)9-18(35-13-30)10-15(23)4)22-12-20(26(32)34-8-2)17(6)29(22)27-28(21)16(19)5;1-2/h5-12H,2-4H2,1H3;9-13H,7-8H2,1-6H3;1-2H3/q;+1;.
What are the key properties of CID 155711171?
CID 155711171 has a molecular weight of 1016.81 g/mol, XLogP of 14.42, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155711171 is sourced from PubChem (CID 155711171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).