About CID 155711194
CID 155711194 (PubChem CID 155711194) has the molecular formula C63H45BF13N2O6
and a molecular weight of 1183.85 g/mol.
Molecular Properties
| Compound Name | CID 155711194 |
| PubChem CID | 155711194 |
| Molecular Formula | C63H45BF13N2O6 |
| Molecular Weight | 1183.85 g/mol |
| Exact Mass | 1183.32 |
| IUPAC Name | — |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(C)=[N+]([B-](F)F)/C1=C(/c1c(F)cc(OC(=O)CCCc2ccc3c4ccc(C(F)(F)F)c5c(C(F)(F)F)ccc(c6ccc(C(F)(F)F)c2c36)c54)cc1F)c1c(C)c(C(=O)OCc2ccccc2)c(C)n1C |
| InChI | InChI=1S/C63H45BF13N2O6/c1-31-49(59(81)83-29-35-13-8-6-9-14-35)33(3)78(5)57(31)56(58-32(2)50(34(4)79(58)64(76)77)60(82)84-30-36-15-10-7-11-16-36)55-46(65)27-38(28-47(55)66)85-48(80)18-12-17-37-19-20-39-41-22-25-44(62(70,71)72)54-45(63(73,74)75)26-23-42(53(41)54)40-21-24-43(61(67,68)69)51(37)52(39)40/h6-11,13-16,19-28H,12,17-18,29-30H2,1-5H3/b58-56- |
| InChIKey | DLFZQCFYVBLDDP-WZQSFHOYSA-N |
| XLogP | 16.54 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 85 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1183.85 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 155711194 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155711194?
The IUPAC name of CID 155711194 (CID 155711194) is not available.
What is the SMILES notation for CID 155711194?
The canonical SMILES for CID 155711194 is CC1=C(C(=O)OCc2ccccc2)C(C)=[N+]([B-](F)F)/C1=C(/c1c(F)cc(OC(=O)CCCc2ccc3c4ccc(C(F)(F)F)c5c(C(F)(F)F)ccc(c6ccc(C(F)(F)F)c2c36)c54)cc1F)c1c(C)c(C(=O)OCc2ccccc2)c(C)n1C.
What is the InChIKey of CID 155711194?
The InChIKey is DLFZQCFYVBLDDP-WZQSFHOYSA-N. The full InChI is InChI=1S/C63H45BF13N2O6/c1-31-49(59(81)83-29-35-13-8-6-9-14-35)33(3)78(5)57(31)56(58-32(2)50(34(4)79(58)64(76)77)60(82)84-30-36-15-10-7-11-16-36)55-46(65)27-38(28-47(55)66)85-48(80)18-12-17-37-19-20-39-41-22-25-44(62(70,71)72)54-45(63(73,74)75)26-23-42(53(41)54)40-21-24-43(61(67,68)69)51(37)52(39)40/h6-11,13-16,19-28H,12,17-18,29-30H2,1-5H3/b58-56-.
What are the key properties of CID 155711194?
CID 155711194 has a molecular weight of 1183.85 g/mol, XLogP of 16.54, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155711194 is sourced from PubChem (CID 155711194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).