C17H16FN7S — CID 155711690
2-(4-fluorophenyl)-2-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetonitrile (PubChem CID 155711690) has the molecular formula C17H16FN7S and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetonitrile.
| Compound Name | 2-(4-fluorophenyl)-2-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetonitrile |
|---|---|
| PubChem CID | 155711690 |
| Molecular Formula | C17H16FN7S |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetonitrile |
| SMILES | Cc1nsc(-c2nnc3n2CCN(C(C#N)c2ccc(F)cc2)[C@@H]3C)n1 |
| InChI | InChI=1S/C17H16FN7S/c1-10-15-21-22-16(17-20-11(2)23-26-17)25(15)8-7-24(10)14(9-19)12-3-5-13(18)6-4-12/h3-6,10,14H,7-8H2,1-2H3/t10-,14?/m1/s1 |
| InChIKey | DTYSJAOIJIRRFR-IAPIXIRKSA-N |
| XLogP | 2.89 |
| TPSA | 83.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |