C14H15N7S — CID 155711786
3-methyl-5-[(8R)-8-methyl-7-pyridin-3-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,2,4-thiadiazole (PubChem CID 155711786) has the molecular formula C14H15N7S and a molecular weight of 313.39 g/mol. Its IUPAC name is 3-methyl-5-[(8R)-8-methyl-7-pyridin-3-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,2,4-thiadiazole.
| Compound Name | 3-methyl-5-[(8R)-8-methyl-7-pyridin-3-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 155711786 |
| Molecular Formula | C14H15N7S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-methyl-5-[(8R)-8-methyl-7-pyridin-3-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,2,4-thiadiazole |
| SMILES | Cc1nsc(-c2nnc3n2CCN(c2cccnc2)[C@@H]3C)n1 |
| InChI | InChI=1S/C14H15N7S/c1-9-12-17-18-13(14-16-10(2)19-22-14)21(12)7-6-20(9)11-4-3-5-15-8-11/h3-5,8-9H,6-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | QJEGWFAPQRPBRL-SECBINFHSA-N |
| XLogP | 2.08 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |