C17H15N5O2 — CID 155711949
N-[3-cyano-2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 155711949) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[3-cyano-2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[3-cyano-2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 155711949 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[3-cyano-2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](c2c(C#N)cccc2NC(=O)c2ncco2)CN1C#N |
| InChI | InChI=1S/C17H15N5O2/c1-11-7-13(9-22(11)10-19)15-12(8-18)3-2-4-14(15)21-16(23)17-20-5-6-24-17/h2-6,11,13H,7,9H2,1H3,(H,21,23)/t11-,13+/m1/s1 |
| InChIKey | BAGAPZYCIDQFEC-YPMHNXCESA-N |
| XLogP | 2.46 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|