C12H18O2 — CID 155712085
(3,3,6,7-tetramethylcyclohepta-1,4,6-trien-1-yl)oxymethanol (PubChem CID 155712085) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3,3,6,7-tetramethylcyclohepta-1,4,6-trien-1-yl)oxymethanol.
| Compound Name | (3,3,6,7-tetramethylcyclohepta-1,4,6-trien-1-yl)oxymethanol |
|---|---|
| PubChem CID | 155712085 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3,3,6,7-tetramethylcyclohepta-1,4,6-trien-1-yl)oxymethanol |
| SMILES | CC1=C(C)C(OCO)=CC(C)(C)C=C1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-6-12(3,4)7-11(10(9)2)14-8-13/h5-7,13H,8H2,1-4H3 |
| InChIKey | QZACRXDPBJWUIU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|