C18H20ClFN2 — CID 155712168
1-N-(2-chloro-6-fluorophenyl)-4-(3-methylpent-1-en-2-yl)benzene-1,3-diamine (PubChem CID 155712168) has the molecular formula C18H20ClFN2 and a molecular weight of 318.82 g/mol. Its IUPAC name is 1-N-(2-chloro-6-fluorophenyl)-4-(3-methylpent-1-en-2-yl)benzene-1,3-diamine.
| Compound Name | 1-N-(2-chloro-6-fluorophenyl)-4-(3-methylpent-1-en-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 155712168 |
| Molecular Formula | C18H20ClFN2 |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-N-(2-chloro-6-fluorophenyl)-4-(3-methylpent-1-en-2-yl)benzene-1,3-diamine |
| SMILES | C=C(c1ccc(Nc2c(F)cccc2Cl)cc1N)C(C)CC |
| InChI | InChI=1S/C18H20ClFN2/c1-4-11(2)12(3)14-9-8-13(10-17(14)21)22-18-15(19)6-5-7-16(18)20/h5-11,22H,3-4,21H2,1-2H3 |
| InChIKey | ZTVINMWSZYZGDL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|