C29H32F3NO4 — CID 155712234
5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylbutanoate (PubChem CID 155712234) has the molecular formula C29H32F3NO4 and a molecular weight of 515.57 g/mol. Its IUPAC name is 5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylbutanoate.
| Compound Name | 5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylbutanoate |
|---|---|
| PubChem CID | 155712234 |
| Molecular Formula | C29H32F3NO4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCOc1ccc2c(c1)CCCC(c1cccc(OC(F)(F)F)c1)=C2C#N |
| InChI | InChI=1S/C29H32F3NO4/c1-3-20(2)28(34)36-16-6-4-5-15-35-23-13-14-26-21(17-23)10-8-12-25(27(26)19-33)22-9-7-11-24(18-22)37-29(30,31)32/h7,9,11,13-14,17-18,20H,3-6,8,10,12,15-16H2,1-2H3 |
| InChIKey | SNPGMYWJFVNZEK-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|