C30H39F3O3 — CID 155712287
2,2-dimethylbutanal;2-(5-methoxypentoxy)-6-[4-(trifluoromethyl)phenyl]-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 155712287) has the molecular formula C30H39F3O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2,2-dimethylbutanal;2-(5-methoxypentoxy)-6-[4-(trifluoromethyl)phenyl]-8,9-dihydro-7H-benzo[7]annulene.
| Compound Name | 2,2-dimethylbutanal;2-(5-methoxypentoxy)-6-[4-(trifluoromethyl)phenyl]-8,9-dihydro-7H-benzo[7]annulene |
|---|---|
| PubChem CID | 155712287 |
| Molecular Formula | C30H39F3O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 2,2-dimethylbutanal;2-(5-methoxypentoxy)-6-[4-(trifluoromethyl)phenyl]-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | CCC(C)(C)C=O.COCCCCCOc1ccc2c(c1)CCCC(c1ccc(C(F)(F)F)cc1)=C2 |
| InChI | InChI=1S/C24H27F3O2.C6H12O/c1-28-14-3-2-4-15-29-23-13-10-21-16-19(6-5-7-20(21)17-23)18-8-11-22(12-9-18)24(25,26)27;1-4-6(2,3)5-7/h8-13,16-17H,2-7,14-15H2,1H3;5H,4H2,1-3H3 |
| InChIKey | GJCKVTDPCZBTGZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|