C31H42O2S — CID 155712373
S-[3-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenoxy]propyl] 2,2,3,5,5-pentamethylhexanethioate (PubChem CID 155712373) has the molecular formula C31H42O2S and a molecular weight of 478.74 g/mol. Its IUPAC name is S-[3-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenoxy]propyl] 2,2,3,5,5-pentamethylhexanethioate.
| Compound Name | S-[3-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenoxy]propyl] 2,2,3,5,5-pentamethylhexanethioate |
|---|---|
| PubChem CID | 155712373 |
| Molecular Formula | C31H42O2S |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | S-[3-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenoxy]propyl] 2,2,3,5,5-pentamethylhexanethioate |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(=O)SCCCOc1ccccc1C1=Cc2ccccc2CCC1 |
| InChI | InChI=1S/C31H42O2S/c1-23(22-30(2,3)4)31(5,6)29(32)34-20-12-19-33-28-18-10-9-17-27(28)26-16-11-15-24-13-7-8-14-25(24)21-26/h7-10,13-14,17-18,21,23H,11-12,15-16,19-20,22H2,1-6H3 |
| InChIKey | MMXPTIRMPCSZSA-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|