About CID 155712415
CID 155712415 (PubChem CID 155712415) has the molecular formula C5H2BF2N
and a molecular weight of 124.89 g/mol.
Molecular Properties
| Compound Name | CID 155712415 |
| PubChem CID | 155712415 |
| Molecular Formula | C5H2BF2N |
| Molecular Weight | 124.89 g/mol |
| Exact Mass | 125.02 |
| IUPAC Name | — |
| SMILES | [B]c1ncc(F)cc1F |
| InChI | InChI=1S/C5H2BF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H |
| InChIKey | DEUZHTQTBJHCSJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.89 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155712415 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155712415?
The IUPAC name of CID 155712415 (CID 155712415) is not available.
What is the SMILES notation for CID 155712415?
The canonical SMILES for CID 155712415 is [B]c1ncc(F)cc1F.
What is the InChIKey of CID 155712415?
The InChIKey is DEUZHTQTBJHCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H.
What are the key properties of CID 155712415?
CID 155712415 has a molecular weight of 124.89 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155712415 is sourced from PubChem (CID 155712415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).