C28H51NO — CID 155712596
(6R,8R,10R,15S)-15-ethyl-3,4,6,10-tetramethyl-8-(3-methylcyclohexyl)-4-azabicyclo[11.2.1]hexadec-13(16)-en-12-ol (PubChem CID 155712596) has the molecular formula C28H51NO and a molecular weight of 417.72 g/mol. Its IUPAC name is (6R,8R,10R,15S)-15-ethyl-3,4,6,10-tetramethyl-8-(3-methylcyclohexyl)-4-azabicyclo[11.2.1]hexadec-13(16)-en-12-ol.
| Compound Name | (6R,8R,10R,15S)-15-ethyl-3,4,6,10-tetramethyl-8-(3-methylcyclohexyl)-4-azabicyclo[11.2.1]hexadec-13(16)-en-12-ol |
|---|---|
| PubChem CID | 155712596 |
| Molecular Formula | C28H51NO |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.40 |
| IUPAC Name | (6R,8R,10R,15S)-15-ethyl-3,4,6,10-tetramethyl-8-(3-methylcyclohexyl)-4-azabicyclo[11.2.1]hexadec-13(16)-en-12-ol |
| SMILES | CC[C@H]1CC2=CC1CC(C)N(C)C[C@H](C)C[C@H](C1CCCC(C)C1)C[C@@H](C)CC2O |
| InChI | InChI=1S/C28H51NO/c1-7-23-16-27-17-26(23)15-22(5)29(6)18-21(4)13-25(12-20(3)14-28(27)30)24-10-8-9-19(2)11-24/h17,19-26,28,30H,7-16,18H2,1-6H3/t19?,20-,21-,22?,23+,24?,25-,26?,28?/m1/s1 |
| InChIKey | DWGAYSPRDIGRMY-RHTGCASJSA-N |
| XLogP | 6.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|