C35H22F6N4+4 — CID 155712645
8-[6-[3,5-difluoro-2-(5-fluoro-1-methylpyridin-1-ium-2-yl)phenyl]-3,8,10-trifluoropyrido[1,2-b]isoindol-5-ium-6-yl]-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 155712645) has the molecular formula C35H22F6N4+4 and a molecular weight of 612.58 g/mol. Its IUPAC name is 8-[6-[3,5-difluoro-2-(5-fluoro-1-methylpyridin-1-ium-2-yl)phenyl]-3,8,10-trifluoropyrido[1,2-b]isoindol-5-ium-6-yl]-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8-[6-[3,5-difluoro-2-(5-fluoro-1-methylpyridin-1-ium-2-yl)phenyl]-3,8,10-trifluoropyrido[1,2-b]isoindol-5-ium-6-yl]-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 155712645 |
| Molecular Formula | C35H22F6N4+4 |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | 8-[6-[3,5-difluoro-2-(5-fluoro-1-methylpyridin-1-ium-2-yl)phenyl]-3,8,10-trifluoropyrido[1,2-b]isoindol-5-ium-6-yl]-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | C[n+]1cc(F)ccc1-c1c(F)cc(F)cc1C1(C2[n+]3ccccc3-c3cccc[n+]32)c2cc(F)cc(F)c2-c2ccc(F)c[n+]21 |
| InChI | InChI=1S/C35H22F6N4/c1-42-18-20(36)8-10-30(42)32-24(14-22(38)16-26(32)40)35(34-43-12-4-2-6-28(43)29-7-3-5-13-44(29)34)25-15-23(39)17-27(41)33(25)31-11-9-21(37)19-45(31)35/h2-19,34H,1H3/q+4 |
| InChIKey | CDTSWWPBFSAQNA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 15.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|