C39H30O4 — CID 155712883
3-[9-(2-carboxyethyl)-2,7-dinaphthalen-1-ylfluoren-9-yl]propanoic acid (PubChem CID 155712883) has the molecular formula C39H30O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-[9-(2-carboxyethyl)-2,7-dinaphthalen-1-ylfluoren-9-yl]propanoic acid.
| Compound Name | 3-[9-(2-carboxyethyl)-2,7-dinaphthalen-1-ylfluoren-9-yl]propanoic acid |
|---|---|
| PubChem CID | 155712883 |
| Molecular Formula | C39H30O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 3-[9-(2-carboxyethyl)-2,7-dinaphthalen-1-ylfluoren-9-yl]propanoic acid |
| SMILES | O=C(O)CCC1(CCC(=O)O)c2cc(-c3cccc4ccccc34)ccc2-c2ccc(-c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C39H30O4/c40-37(41)19-21-39(22-20-38(42)43)35-23-27(31-13-5-9-25-7-1-3-11-29(25)31)15-17-33(35)34-18-16-28(24-36(34)39)32-14-6-10-26-8-2-4-12-30(26)32/h1-18,23-24H,19-22H2,(H,40,41)(H,42,43) |
| InChIKey | GLYNWSDUJKAWHS-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |