About 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine
4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine (PubChem CID 155712995) has the molecular formula C15H14F5N3O
and a molecular weight of 347.29 g/mol. Its IUPAC name is 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine.
Molecular Properties
| Compound Name | 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine |
| PubChem CID | 155712995 |
| Molecular Formula | C15H14F5N3O |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine |
| SMILES | CNN.O=Cc1cc(F)c(F)cc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H8F5NO.CH6N2/c15-11-5-8(7-21)13(6-12(11)16)20-10-3-1-9(2-4-10)14(17,18)19;1-3-2/h1-7,20H;3H,2H2,1H3 |
| InChIKey | DZNFQEOJLASGHU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine?
The IUPAC name of 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine (CID 155712995) is 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine.
What is the SMILES notation for 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine?
The canonical SMILES for 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine is CNN.O=Cc1cc(F)c(F)cc1Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine?
The InChIKey is DZNFQEOJLASGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F5NO.CH6N2/c15-11-5-8(7-21)13(6-12(11)16)20-10-3-1-9(2-4-10)14(17,18)19;1-3-2/h1-7,20H;3H,2H2,1H3.
What are the key properties of 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine?
4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine has a molecular weight of 347.29 g/mol, XLogP of 3.62, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-2-[4-(trifluoromethyl)anilino]benzaldehyde;methylhydrazine is sourced from PubChem (CID 155712995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).