About (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone
(5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone (PubChem CID 155713337) has the molecular formula C15H12F2N2OS
and a molecular weight of 306.34 g/mol. Its IUPAC name is (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone |
| PubChem CID | 155713337 |
| Molecular Formula | C15H12F2N2OS |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone |
| SMILES | CCCc1csc(C(=O)c2c[nH]c3cc(F)c(F)cc23)n1 |
| InChI | InChI=1S/C15H12F2N2OS/c1-2-3-8-7-21-15(19-8)14(20)10-6-18-13-5-12(17)11(16)4-9(10)13/h4-7,18H,2-3H2,1H3 |
| InChIKey | IOBSIVFCIQAPFK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone?
The IUPAC name of (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone (CID 155713337) is (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone?
The canonical SMILES for (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone is CCCc1csc(C(=O)c2c[nH]c3cc(F)c(F)cc23)n1.
What is the InChIKey of (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone?
The InChIKey is IOBSIVFCIQAPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2OS/c1-2-3-8-7-21-15(19-8)14(20)10-6-18-13-5-12(17)11(16)4-9(10)13/h4-7,18H,2-3H2,1H3.
What are the key properties of (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone?
(5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone has a molecular weight of 306.34 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-difluoro-1H-indol-3-yl)-(4-propyl-1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 155713337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).