C17H13F3N4O4S — CID 155713512
5-methoxy-5'-pyridin-3-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155713512) has the molecular formula C17H13F3N4O4S and a molecular weight of 426.38 g/mol. Its IUPAC name is 5-methoxy-5'-pyridin-3-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-methoxy-5'-pyridin-3-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155713512 |
| Molecular Formula | C17H13F3N4O4S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 5-methoxy-5'-pyridin-3-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c(c1)C1(NN=C(c3cccnc3)S1)C(=O)N2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H12N4O2S.C2HF3O2/c1-21-10-4-5-12-11(7-10)15(14(20)17-12)19-18-13(22-15)9-3-2-6-16-8-9;3-2(4,5)1(6)7/h2-8,19H,1H3,(H,17,20);(H,6,7) |
| InChIKey | ARGMQHQSJNHUJY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|