C5H2F8O — CID 155713541
2,3,3,3-tetrafluoro-1-(1,1,2,2-tetrafluoroethoxy)prop-1-ene (PubChem CID 155713541) has the molecular formula C5H2F8O and a molecular weight of 230.05 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-1-(1,1,2,2-tetrafluoroethoxy)prop-1-ene.
| Compound Name | 2,3,3,3-tetrafluoro-1-(1,1,2,2-tetrafluoroethoxy)prop-1-ene |
|---|---|
| PubChem CID | 155713541 |
| Molecular Formula | C5H2F8O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2,3,3,3-tetrafluoro-1-(1,1,2,2-tetrafluoroethoxy)prop-1-ene |
| SMILES | FC(=COC(F)(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F8O/c6-2(4(9,10)11)1-14-5(12,13)3(7)8/h1,3H |
| InChIKey | PWZKJFKMUYMPIR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|