C24H24O5 — CID 15571368
2-[3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoyl]-5-phenylcyclohexane-1,3-dione (PubChem CID 15571368) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoyl]-5-phenylcyclohexane-1,3-dione.
| Compound Name | 2-[3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoyl]-5-phenylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 15571368 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[3-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanoyl]-5-phenylcyclohexane-1,3-dione |
| SMILES | CC1(C)Oc2ccc(CCC(=O)C3C(=O)CC(c4ccccc4)CC3=O)cc2O1 |
| InChI | InChI=1S/C24H24O5/c1-24(2)28-21-11-9-15(12-22(21)29-24)8-10-18(25)23-19(26)13-17(14-20(23)27)16-6-4-3-5-7-16/h3-7,9,11-12,17,23H,8,10,13-14H2,1-2H3 |
| InChIKey | BEKVIDUNKNJXRR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|