About (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol
(E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol (PubChem CID 155713771) has the molecular formula C19H21N3O2S
and a molecular weight of 355.46 g/mol. Its IUPAC name is (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol.
Molecular Properties
| Compound Name | (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol |
| PubChem CID | 155713771 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol |
| SMILES | CS.Cc1cccc(-n2ncc3cc(C)c(NC(=O)/C=C/O)cc32)c1 |
| InChI | InChI=1S/C18H17N3O2.CH4S/c1-12-4-3-5-15(8-12)21-17-10-16(20-18(23)6-7-22)13(2)9-14(17)11-19-21;1-2/h3-11,22H,1-2H3,(H,20,23);2H,1H3/b7-6+; |
| InChIKey | YPJBQYQZRJEASY-UHDJGPCESA-N |
| XLogP | 4.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol?
The IUPAC name of (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol (CID 155713771) is (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol.
What is the SMILES notation for (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol?
The canonical SMILES for (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol is CS.Cc1cccc(-n2ncc3cc(C)c(NC(=O)/C=C/O)cc32)c1.
What is the InChIKey of (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol?
The InChIKey is YPJBQYQZRJEASY-UHDJGPCESA-N. The full InChI is InChI=1S/C18H17N3O2.CH4S/c1-12-4-3-5-15(8-12)21-17-10-16(20-18(23)6-7-22)13(2)9-14(17)11-19-21;1-2/h3-11,22H,1-2H3,(H,20,23);2H,1H3/b7-6+;.
What are the key properties of (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol?
(E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol has a molecular weight of 355.46 g/mol, XLogP of 4.20, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-hydroxy-N-[5-methyl-1-(3-methylphenyl)indazol-6-yl]prop-2-enamide;methanethiol is sourced from PubChem (CID 155713771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).