C17H23BFN3O2 — CID 155713888
5-fluoro-2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]pyridine (PubChem CID 155713888) has the molecular formula C17H23BFN3O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 5-fluoro-2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]pyridine.
| Compound Name | 5-fluoro-2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]pyridine |
|---|---|
| PubChem CID | 155713888 |
| Molecular Formula | C17H23BFN3O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 5-fluoro-2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]pyridine |
| SMILES | CCC(c1ccc(F)cn1)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C17H23BFN3O2/c1-6-15(14-8-7-13(19)10-20-14)22-11-12(9-21-22)18-23-16(2,3)17(4,5)24-18/h7-11,15H,6H2,1-5H3 |
| InChIKey | DSWJSIPIJQSGDT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|