C18H23BF3N3O2 — CID 155713958
4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]-2-(trifluoromethyl)pyridine (PubChem CID 155713958) has the molecular formula C18H23BF3N3O2 and a molecular weight of 381.21 g/mol. Its IUPAC name is 4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 155713958 |
| Molecular Formula | C18H23BF3N3O2 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propyl]-2-(trifluoromethyl)pyridine |
| SMILES | CCC(c1ccnc(C(F)(F)F)c1)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C18H23BF3N3O2/c1-6-14(12-7-8-23-15(9-12)18(20,21)22)25-11-13(10-24-25)19-26-16(2,3)17(4,5)27-19/h7-11,14H,6H2,1-5H3 |
| InChIKey | PSYAVDQTOJAZNF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|