C22H30Cl2N5O6P — CID 155713999
4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazole-5-carboxamide;2,2-dimethylpropanoyloxymethoxyphosphinous acid (PubChem CID 155713999) has the molecular formula C22H30Cl2N5O6P and a molecular weight of 562.39 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazole-5-carboxamide;2,2-dimethylpropanoyloxymethoxyphosphinous acid.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazole-5-carboxamide;2,2-dimethylpropanoyloxymethoxyphosphinous acid |
|---|---|
| PubChem CID | 155713999 |
| Molecular Formula | C22H30Cl2N5O6P |
| Molecular Weight | 562.39 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazole-5-carboxamide;2,2-dimethylpropanoyloxymethoxyphosphinous acid |
| SMILES | CC(C)(C)C(=O)OCOPO.O=C(NC1CCNCC1)c1[nH]ncc1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H17Cl2N5O2.C6H13O4P/c17-10-2-1-3-11(18)13(10)15(24)22-12-8-20-23-14(12)16(25)21-9-4-6-19-7-5-9;1-6(2,3)5(7)9-4-10-11-8/h1-3,8-9,19H,4-7H2,(H,20,23)(H,21,25)(H,22,24);8,11H,4H2,1-3H3 |
| InChIKey | ARVQAYRZSKEEMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|