C10H14F3N3O2 — CID 155714287
2-piperidin-2-yl-5-(3,3,3-trifluoropropoxy)-1,3,4-oxadiazole (PubChem CID 155714287) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-piperidin-2-yl-5-(3,3,3-trifluoropropoxy)-1,3,4-oxadiazole.
| Compound Name | 2-piperidin-2-yl-5-(3,3,3-trifluoropropoxy)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155714287 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-piperidin-2-yl-5-(3,3,3-trifluoropropoxy)-1,3,4-oxadiazole |
| SMILES | FC(F)(F)CCOc1nnc(C2CCCCN2)o1 |
| InChI | InChI=1S/C10H14F3N3O2/c11-10(12,13)4-6-17-9-16-15-8(18-9)7-3-1-2-5-14-7/h7,14H,1-6H2 |
| InChIKey | QROWLDUVDWBQEP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |