C17H22BIN2O5S — CID 155714527
ethyl 1-iodosulfanyl-6-methyl-7-oxo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 155714527) has the molecular formula C17H22BIN2O5S and a molecular weight of 504.16 g/mol. Its IUPAC name is ethyl 1-iodosulfanyl-6-methyl-7-oxo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 1-iodosulfanyl-6-methyl-7-oxo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 155714527 |
| Molecular Formula | C17H22BIN2O5S |
| Molecular Weight | 504.16 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | ethyl 1-iodosulfanyl-6-methyl-7-oxo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(B3OC(C)(C)C(C)(C)O3)cn(C)c(=O)c2n1SI |
| InChI | InChI=1S/C17H22BIN2O5S/c1-7-24-15(23)12-8-10-11(18-25-16(2,3)17(4,5)26-18)9-20(6)14(22)13(10)21(12)27-19/h8-9H,7H2,1-6H3 |
| InChIKey | VJCBZORDQYMKEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|