C27H31FN4O4 — CID 155714561
2-[3-[[(2S)-5,5-dimethyl-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(2-ethyl-3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 155714561) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[3-[[(2S)-5,5-dimethyl-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(2-ethyl-3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[3-[[(2S)-5,5-dimethyl-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(2-ethyl-3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 155714561 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[3-[[(2S)-5,5-dimethyl-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(2-ethyl-3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | CCc1c(F)cccc1Nc1c(-c2ccncc2OC[C@H]2COC(C)(C)CO2)[nH]c2c1C(=O)NCC2 |
| InChI | InChI=1S/C27H31FN4O4/c1-4-17-19(28)6-5-7-20(17)31-25-23-21(9-11-30-26(23)33)32-24(25)18-8-10-29-12-22(18)34-13-16-14-36-27(2,3)15-35-16/h5-8,10,12,16,31-32H,4,9,11,13-15H2,1-3H3,(H,30,33)/t16-/m0/s1 |
| InChIKey | NKJYGCOXJCWQJL-INIZCTEOSA-N |
| XLogP | 4.38 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |