C38H31BN4 — CID 155714731
8,16-bis(2,4,6-trimethylphenyl)-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10(23),11,13,16,18,20,22(24)-undecaene (PubChem CID 155714731) has the molecular formula C38H31BN4 and a molecular weight of 554.51 g/mol. Its IUPAC name is 8,16-bis(2,4,6-trimethylphenyl)-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10(23),11,13,16,18,20,22(24)-undecaene.
| Compound Name | 8,16-bis(2,4,6-trimethylphenyl)-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10(23),11,13,16,18,20,22(24)-undecaene |
|---|---|
| PubChem CID | 155714731 |
| Molecular Formula | C38H31BN4 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 8,16-bis(2,4,6-trimethylphenyl)-7,9,15,17-tetraza-1-boraheptacyclo[12.8.1.12,6.115,18.010,23.09,25.022,24]pentacosa-2(25),3,5,7,10(23),11,13,16,18,20,22(24)-undecaene |
| SMILES | Cc1cc(C)c(-c2nc3cccc4c3n2-c2cccc3c2B4c2cccc4nc(-c5c(C)cc(C)cc5C)n-3c24)c(C)c1 |
| InChI | InChI=1S/C38H31BN4/c1-20-16-22(3)32(23(4)17-20)37-40-28-12-7-10-26-35(28)42(37)30-14-9-15-31-34(30)39(26)27-11-8-13-29-36(27)43(31)38(41-29)33-24(5)18-21(2)19-25(33)6/h7-19H,1-6H3 |
| InChIKey | PPNKHKVBMIJIAD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|