About [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide
[4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide (PubChem CID 155715220) has the molecular formula C17H15BrClN3O2Se
and a molecular weight of 487.64 g/mol. Its IUPAC name is [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide.
Molecular Properties
| Compound Name | [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide |
| PubChem CID | 155715220 |
| Molecular Formula | C17H15BrClN3O2Se |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 486.92 |
| IUPAC Name | [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)[Se]Cc1ccc(CN2C(=O)C(=O)c3cccc(Cl)c32)cc1 |
| InChI | InChI=1S/C17H14ClN3O2Se.BrH/c18-13-3-1-2-12-14(13)21(16(23)15(12)22)8-10-4-6-11(7-5-10)9-24-17(19)20;/h1-7H,8-9H2,(H3,19,20);1H |
| InChIKey | MAUZJUDTMADTBF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide?
The IUPAC name of [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide (CID 155715220) is [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide.
What is the SMILES notation for [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide?
The canonical SMILES for [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide is Br.[H]/N=C(\N)[Se]Cc1ccc(CN2C(=O)C(=O)c3cccc(Cl)c32)cc1.
What is the InChIKey of [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide?
The InChIKey is MAUZJUDTMADTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O2Se.BrH/c18-13-3-1-2-12-14(13)21(16(23)15(12)22)8-10-4-6-11(7-5-10)9-24-17(19)20;/h1-7H,8-9H2,(H3,19,20);1H.
What are the key properties of [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide?
[4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide has a molecular weight of 487.64 g/mol, XLogP of 2.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(7-chloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate;hydrobromide is sourced from PubChem (CID 155715220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).