C18H15FN4O3 — CID 155715317
3-[6-[[1-(fluoromethyl)pyrazol-4-yl]-dihydroxymethyl]-3-methoxy-2-pyridinyl]benzonitrile (PubChem CID 155715317) has the molecular formula C18H15FN4O3 and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-[6-[[1-(fluoromethyl)pyrazol-4-yl]-dihydroxymethyl]-3-methoxy-2-pyridinyl]benzonitrile.
| Compound Name | 3-[6-[[1-(fluoromethyl)pyrazol-4-yl]-dihydroxymethyl]-3-methoxy-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 155715317 |
| Molecular Formula | C18H15FN4O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-[6-[[1-(fluoromethyl)pyrazol-4-yl]-dihydroxymethyl]-3-methoxy-2-pyridinyl]benzonitrile |
| SMILES | COc1ccc(C(O)(O)c2cnn(CF)c2)nc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H15FN4O3/c1-26-15-5-6-16(18(24,25)14-9-21-23(10-14)11-19)22-17(15)13-4-2-3-12(7-13)8-20/h2-7,9-10,24-25H,11H2,1H3 |
| InChIKey | SUCCCPQESRLLAY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|