About ethane;methyl dithiolane-4-carboxylate
ethane;methyl dithiolane-4-carboxylate (PubChem CID 155715678) has the molecular formula C7H14O2S2
and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;methyl dithiolane-4-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl dithiolane-4-carboxylate |
| PubChem CID | 155715678 |
| Molecular Formula | C7H14O2S2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | ethane;methyl dithiolane-4-carboxylate |
| SMILES | CC.COC(=O)C1CSSC1 |
| InChI | InChI=1S/C5H8O2S2.C2H6/c1-7-5(6)4-2-8-9-3-4;1-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | LJONQUCAGRRFMW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl dithiolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl dithiolane-4-carboxylate?
The IUPAC name of ethane;methyl dithiolane-4-carboxylate (CID 155715678) is ethane;methyl dithiolane-4-carboxylate.
What is the SMILES notation for ethane;methyl dithiolane-4-carboxylate?
The canonical SMILES for ethane;methyl dithiolane-4-carboxylate is CC.COC(=O)C1CSSC1.
What is the InChIKey of ethane;methyl dithiolane-4-carboxylate?
The InChIKey is LJONQUCAGRRFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S2.C2H6/c1-7-5(6)4-2-8-9-3-4;1-2/h4H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;methyl dithiolane-4-carboxylate?
ethane;methyl dithiolane-4-carboxylate has a molecular weight of 194.32 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl dithiolane-4-carboxylate is sourced from PubChem (CID 155715678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).