C16H15ClF3N3O3S — CID 155715727
ethane;[N'-[3-(trifluoromethoxy)benzoyl]carbamimidoyl] 5-chlorothiophene-2-carboximidate (PubChem CID 155715727) has the molecular formula C16H15ClF3N3O3S and a molecular weight of 421.83 g/mol. Its IUPAC name is ethane;[N'-[3-(trifluoromethoxy)benzoyl]carbamimidoyl] 5-chlorothiophene-2-carboximidate.
| Compound Name | ethane;[N'-[3-(trifluoromethoxy)benzoyl]carbamimidoyl] 5-chlorothiophene-2-carboximidate |
|---|---|
| PubChem CID | 155715727 |
| Molecular Formula | C16H15ClF3N3O3S |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | ethane;[N'-[3-(trifluoromethoxy)benzoyl]carbamimidoyl] 5-chlorothiophene-2-carboximidate |
| SMILES | CC.[H]/N=C(/O/C(N)=N/C(=O)c1cccc(OC(F)(F)F)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H9ClF3N3O3S.C2H6/c15-10-5-4-9(25-10)11(19)23-13(20)21-12(22)7-2-1-3-8(6-7)24-14(16,17)18;1-2/h1-6,19H,(H2,20,21,22);1-2H3/b19-11+; |
| InChIKey | BTFDEWFWIUYQSH-YLFUTEQJSA-N |
| XLogP | 4.82 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|