About 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane
2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane (PubChem CID 155716211) has the molecular formula C16H16Cl2N2
and a molecular weight of 307.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane |
| PubChem CID | 155716211 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane |
| SMILES | CC.Cc1c(-c2ccc(Cl)cc2Cl)nc2ccccn12 |
| InChI | InChI=1S/C14H10Cl2N2.C2H6/c1-9-14(11-6-5-10(15)8-12(11)16)17-13-4-2-3-7-18(9)13;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | GJSUCSMZRKLZJJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane?
The IUPAC name of 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane (CID 155716211) is 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane?
The canonical SMILES for 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane is CC.Cc1c(-c2ccc(Cl)cc2Cl)nc2ccccn12.
What is the InChIKey of 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane?
The InChIKey is GJSUCSMZRKLZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2.C2H6/c1-9-14(11-6-5-10(15)8-12(11)16)17-13-4-2-3-7-18(9)13;1-2/h2-8H,1H3;1-2H3.
What are the key properties of 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane?
2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane has a molecular weight of 307.22 g/mol, XLogP of 5.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-3-methylimidazo[1,2-a]pyridine;ethane is sourced from PubChem (CID 155716211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).