About 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane
1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane (PubChem CID 155716435) has the molecular formula C21H39O7P
and a molecular weight of 434.51 g/mol. Its IUPAC name is 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane |
| PubChem CID | 155716435 |
| Molecular Formula | C21H39O7P |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane |
| SMILES | C=C1CCCC(C)C1.CCCOC(=O)CC(C(=O)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H25O7P.C8H14/c1-5-9-18-12(14)10-11(13(15)17-6-2)21(16,19-7-3)20-8-4;1-7-4-3-5-8(2)6-7/h11H,5-10H2,1-4H3;8H,1,3-6H2,2H3 |
| InChIKey | OJYHUTPFFQMOQA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane?
The IUPAC name of 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane (CID 155716435) is 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane.
What is the SMILES notation for 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane?
The canonical SMILES for 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane is C=C1CCCC(C)C1.CCCOC(=O)CC(C(=O)OCC)P(=O)(OCC)OCC.
What is the InChIKey of 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane?
The InChIKey is OJYHUTPFFQMOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O7P.C8H14/c1-5-9-18-12(14)10-11(13(15)17-6-2)21(16,19-7-3)20-8-4;1-7-4-3-5-8(2)6-7/h11H,5-10H2,1-4H3;8H,1,3-6H2,2H3.
What are the key properties of 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane?
1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane has a molecular weight of 434.51 g/mol, XLogP of 5.28, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-propyl 2-diethoxyphosphorylbutanedioate;1-methyl-3-methylidenecyclohexane is sourced from PubChem (CID 155716435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).