C12H20N2 — CID 15571646
N,N-diethyl-4,5,6,7-tetrahydro-2H-isoindol-5-amine (PubChem CID 15571646) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N,N-diethyl-4,5,6,7-tetrahydro-2H-isoindol-5-amine.
| Compound Name | N,N-diethyl-4,5,6,7-tetrahydro-2H-isoindol-5-amine |
|---|---|
| PubChem CID | 15571646 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N,N-diethyl-4,5,6,7-tetrahydro-2H-isoindol-5-amine |
| SMILES | CCN(CC)C1CCc2c[nH]cc2C1 |
| InChI | InChI=1S/C12H20N2/c1-3-14(4-2)12-6-5-10-8-13-9-11(10)7-12/h8-9,12-13H,3-7H2,1-2H3 |
| InChIKey | XHJSNZVFNFCSOD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |