C16H23N3 — CID 155716536
N-(1-cyclopentyl-3-methylidene-5-prop-1-en-2-ylpyrrol-2-ylidene)-N'-methylethanimidamide (PubChem CID 155716536) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(1-cyclopentyl-3-methylidene-5-prop-1-en-2-ylpyrrol-2-ylidene)-N'-methylethanimidamide.
| Compound Name | N-(1-cyclopentyl-3-methylidene-5-prop-1-en-2-ylpyrrol-2-ylidene)-N'-methylethanimidamide |
|---|---|
| PubChem CID | 155716536 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-(1-cyclopentyl-3-methylidene-5-prop-1-en-2-ylpyrrol-2-ylidene)-N'-methylethanimidamide |
| SMILES | C=C(C)C1=CC(=C)/C(=N\C(C)=N\C)N1C1CCCC1 |
| InChI | InChI=1S/C16H23N3/c1-11(2)15-10-12(3)16(18-13(4)17-5)19(15)14-8-6-7-9-14/h10,14H,1,3,6-9H2,2,4-5H3/b17-13+,18-16+ |
| InChIKey | IDQUFECGHZFUOD-UXHPWICLSA-N |
| XLogP | 3.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|