C19H37FN2 — CID 155716813
1-fluoro-4-(2,2,4,4-tetramethyl-5-piperidin-4-ylpentyl)piperidine (PubChem CID 155716813) has the molecular formula C19H37FN2 and a molecular weight of 312.52 g/mol. Its IUPAC name is 1-fluoro-4-(2,2,4,4-tetramethyl-5-piperidin-4-ylpentyl)piperidine.
| Compound Name | 1-fluoro-4-(2,2,4,4-tetramethyl-5-piperidin-4-ylpentyl)piperidine |
|---|---|
| PubChem CID | 155716813 |
| Molecular Formula | C19H37FN2 |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | 1-fluoro-4-(2,2,4,4-tetramethyl-5-piperidin-4-ylpentyl)piperidine |
| SMILES | CC(C)(CC1CCNCC1)CC(C)(C)CC1CCN(F)CC1 |
| InChI | InChI=1S/C19H37FN2/c1-18(2,13-16-5-9-21-10-6-16)15-19(3,4)14-17-7-11-22(20)12-8-17/h16-17,21H,5-15H2,1-4H3 |
| InChIKey | KHAQRMCNQRZQAI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|