About dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane
dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane (PubChem CID 155716927) has the molecular formula C6H7Cl2OP
and a molecular weight of 197.00 g/mol. Its IUPAC name is dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane.
Molecular Properties
| Compound Name | dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane |
| PubChem CID | 155716927 |
| Molecular Formula | C6H7Cl2OP |
| Molecular Weight | 197.00 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane |
| SMILES | ClP(Cl)OC1=CCCC=C1 |
| InChI | InChI=1S/C6H7Cl2OP/c7-10(8)9-6-4-2-1-3-5-6/h2,4-5H,1,3H2 |
| InChIKey | IXVVDSBPEURPMX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.00 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane?
The IUPAC name of dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane (CID 155716927) is dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane.
What is the SMILES notation for dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane?
The canonical SMILES for dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane is ClP(Cl)OC1=CCCC=C1.
What is the InChIKey of dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane?
The InChIKey is IXVVDSBPEURPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2OP/c7-10(8)9-6-4-2-1-3-5-6/h2,4-5H,1,3H2.
What are the key properties of dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane?
dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane has a molecular weight of 197.00 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(cyclohexa-1,5-dien-1-yloxy)phosphane is sourced from PubChem (CID 155716927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).