C24H29ClF2N2O4 — CID 155717141
6-chloro-3,4-dihydro-2H-chromene;2-(3,4-difluorophenoxy)-N-(3-formamidobutyl)acetamide;ethene (PubChem CID 155717141) has the molecular formula C24H29ClF2N2O4 and a molecular weight of 482.96 g/mol. Its IUPAC name is 6-chloro-3,4-dihydro-2H-chromene;2-(3,4-difluorophenoxy)-N-(3-formamidobutyl)acetamide;ethene.
| Compound Name | 6-chloro-3,4-dihydro-2H-chromene;2-(3,4-difluorophenoxy)-N-(3-formamidobutyl)acetamide;ethene |
|---|---|
| PubChem CID | 155717141 |
| Molecular Formula | C24H29ClF2N2O4 |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 6-chloro-3,4-dihydro-2H-chromene;2-(3,4-difluorophenoxy)-N-(3-formamidobutyl)acetamide;ethene |
| SMILES | C=C.CC(CCNC(=O)COc1ccc(F)c(F)c1)NC=O.Clc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C13H16F2N2O3.C9H9ClO.C2H4/c1-9(17-8-18)4-5-16-13(19)7-20-10-2-3-11(14)12(15)6-10;10-8-3-4-9-7(6-8)2-1-5-11-9;1-2/h2-3,6,8-9H,4-5,7H2,1H3,(H,16,19)(H,17,18);3-4,6H,1-2,5H2;1-2H2 |
| InChIKey | JNHDAQNVIHTUSK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|