About 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine
5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine (PubChem CID 155717286) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine.
Analyze 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine?
The IUPAC name of 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine (CID 155717286) is 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine.
What is the SMILES notation for 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine?
The canonical SMILES for 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine is C=CC1=C(C=C)N(C)CC(C)O1.
What is the InChIKey of 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine?
The InChIKey is NORNSWCZVZFTAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-9-10(6-2)12-8(3)7-11(9)4/h5-6,8H,1-2,7H2,3-4H3.
What are the key properties of 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine?
5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine has a molecular weight of 165.24 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-2,4-dimethyl-2,3-dihydro-1,4-oxazine is sourced from PubChem (CID 155717286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).