About [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol
[4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol (PubChem CID 155717566) has the molecular formula C14H25N5O
and a molecular weight of 279.39 g/mol. Its IUPAC name is [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol |
| PubChem CID | 155717566 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol |
| SMILES | CCCCC1(CO)CCN(c2ncnc(N)c2N)CC1 |
| InChI | InChI=1S/C14H25N5O/c1-2-3-4-14(9-20)5-7-19(8-6-14)13-11(15)12(16)17-10-18-13/h10,20H,2-9,15H2,1H3,(H2,16,17,18) |
| InChIKey | QYYPIUOPTIBNKK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol?
The IUPAC name of [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol (CID 155717566) is [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol.
What is the SMILES notation for [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol?
The canonical SMILES for [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol is CCCCC1(CO)CCN(c2ncnc(N)c2N)CC1.
What is the InChIKey of [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol?
The InChIKey is QYYPIUOPTIBNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O/c1-2-3-4-14(9-20)5-7-19(8-6-14)13-11(15)12(16)17-10-18-13/h10,20H,2-9,15H2,1H3,(H2,16,17,18).
What are the key properties of [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol?
[4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol has a molecular weight of 279.39 g/mol, XLogP of 1.41, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-butyl-1-(5,6-diaminopyrimidin-4-yl)piperidin-4-yl]methanol is sourced from PubChem (CID 155717566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).